C12H19BrN2O2 — CID 114889791
2-[2-(aminomethyl)-4-bromo-N-(2-methoxyethyl)anilino]ethanol (PubChem CID 114889791) has the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-bromo-N-(2-methoxyethyl)anilino]ethanol.
| Compound Name | 2-[2-(aminomethyl)-4-bromo-N-(2-methoxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 114889791 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-[2-(aminomethyl)-4-bromo-N-(2-methoxyethyl)anilino]ethanol |
| SMILES | COCCN(CCO)c1ccc(Br)cc1CN |
| InChI | InChI=1S/C12H19BrN2O2/c1-17-7-5-15(4-6-16)12-3-2-11(13)8-10(12)9-14/h2-3,8,16H,4-7,9,14H2,1H3 |
| InChIKey | QLCUNSHQARBZBR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |