C11H17ClN2O2 — CID 62493136
2-[2-(aminomethyl)-4-chloro-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 62493136) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-chloro-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[2-(aminomethyl)-4-chloro-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 62493136 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[2-(aminomethyl)-4-chloro-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | NCc1cc(Cl)ccc1N(CCO)CCO |
| InChI | InChI=1S/C11H17ClN2O2/c12-10-1-2-11(9(7-10)8-13)14(3-5-15)4-6-16/h1-2,7,15-16H,3-6,8,13H2 |
| InChIKey | BIAJACUTULWGAW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |