C7H8Cl3N — CID 11356322
(2,5-dichlorophenyl)methanamine;hydrochloride (PubChem CID 11356322) has the molecular formula C7H8Cl3N and a molecular weight of 212.51 g/mol. Its IUPAC name is (2,5-dichlorophenyl)methanamine;hydrochloride.
| Compound Name | (2,5-dichlorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 11356322 |
| Molecular Formula | C7H8Cl3N |
| Molecular Weight | 212.51 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | (2,5-dichlorophenyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H7Cl2N.ClH/c8-6-1-2-7(9)5(3-6)4-10;/h1-3H,4,10H2;1H |
| InChIKey | HVNKYAIWUNGQDU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |