C7H6Cl2S — CID 21489083
(2,5-dichlorophenyl)methanethiol (PubChem CID 21489083) has the molecular formula C7H6Cl2S and a molecular weight of 193.10 g/mol. Its IUPAC name is (2,5-dichlorophenyl)methanethiol.
| Compound Name | (2,5-dichlorophenyl)methanethiol |
|---|---|
| PubChem CID | 21489083 |
| Molecular Formula | C7H6Cl2S |
| Molecular Weight | 193.10 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | (2,5-dichlorophenyl)methanethiol |
| SMILES | SCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H6Cl2S/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2 |
| InChIKey | OZLPKTUDTRJRAF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|