C7H8Cl2NO+ — CID 3797844
(2,5-dichlorophenyl)methoxyazanium (PubChem CID 3797844) has the molecular formula C7H8Cl2NO+ and a molecular weight of 193.05 g/mol. Its IUPAC name is (2,5-dichlorophenyl)methoxyazanium.
| Compound Name | (2,5-dichlorophenyl)methoxyazanium |
|---|---|
| PubChem CID | 3797844 |
| Molecular Formula | C7H8Cl2NO+ |
| Molecular Weight | 193.05 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | (2,5-dichlorophenyl)methoxyazanium |
| SMILES | [NH3+]OCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H8Cl2NO/c8-6-1-2-7(9)5(3-6)4-11-10/h1-3H,4H2,10H3/q+1 |
| InChIKey | NSXXOPSXCJXBDB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.05 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|