C14H10BrCl3O — CID 65316926
2-(bromomethyl)-4-chloro-1-[(2,5-dichlorophenyl)methoxy]benzene (PubChem CID 65316926) has the molecular formula C14H10BrCl3O and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-(bromomethyl)-4-chloro-1-[(2,5-dichlorophenyl)methoxy]benzene.
| Compound Name | 2-(bromomethyl)-4-chloro-1-[(2,5-dichlorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 65316926 |
| Molecular Formula | C14H10BrCl3O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 377.90 |
| IUPAC Name | 2-(bromomethyl)-4-chloro-1-[(2,5-dichlorophenyl)methoxy]benzene |
| SMILES | Clc1ccc(Cl)c(COc2ccc(Cl)cc2CBr)c1 |
| InChI | InChI=1S/C14H10BrCl3O/c15-7-9-5-12(17)2-4-14(9)19-8-10-6-11(16)1-3-13(10)18/h1-6H,7-8H2 |
| InChIKey | KDTHOHFNIGXSCD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|