C16H10BrClF6O — CID 89437755
1-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-(bromomethyl)-4-chlorobenzene (PubChem CID 89437755) has the molecular formula C16H10BrClF6O and a molecular weight of 447.60 g/mol. Its IUPAC name is 1-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-(bromomethyl)-4-chlorobenzene.
| Compound Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-(bromomethyl)-4-chlorobenzene |
|---|---|
| PubChem CID | 89437755 |
| Molecular Formula | C16H10BrClF6O |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-(bromomethyl)-4-chlorobenzene |
| SMILES | FC(F)(F)c1ccc(COc2ccc(Cl)cc2CBr)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10BrClF6O/c17-7-10-5-12(18)3-4-14(10)25-8-9-1-2-11(15(19,20)21)6-13(9)16(22,23)24/h1-6H,7-8H2 |
| InChIKey | GHTAGPBFQKMVRE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|