C7H8Cl3N — CID 174958411
azane;1,4-dichloro-2-(chloromethyl)benzene (PubChem CID 174958411) has the molecular formula C7H8Cl3N and a molecular weight of 212.51 g/mol. Its IUPAC name is azane;1,4-dichloro-2-(chloromethyl)benzene.
| Compound Name | azane;1,4-dichloro-2-(chloromethyl)benzene |
|---|---|
| PubChem CID | 174958411 |
| Molecular Formula | C7H8Cl3N |
| Molecular Weight | 212.51 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | azane;1,4-dichloro-2-(chloromethyl)benzene |
| SMILES | ClCc1cc(Cl)ccc1Cl.N |
| InChI | InChI=1S/C7H5Cl3.H3N/c8-4-5-3-6(9)1-2-7(5)10;/h1-3H,4H2;1H3 |
| InChIKey | FPXJAAJLXYNKGR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|