C10H11Cl3 — CID 64664629
1,4-dichloro-2-(3-chloro-2-methylpropyl)benzene (PubChem CID 64664629) has the molecular formula C10H11Cl3 and a molecular weight of 237.56 g/mol. Its IUPAC name is 1,4-dichloro-2-(3-chloro-2-methylpropyl)benzene.
| Compound Name | 1,4-dichloro-2-(3-chloro-2-methylpropyl)benzene |
|---|---|
| PubChem CID | 64664629 |
| Molecular Formula | C10H11Cl3 |
| Molecular Weight | 237.56 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 1,4-dichloro-2-(3-chloro-2-methylpropyl)benzene |
| SMILES | CC(CCl)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H11Cl3/c1-7(6-11)4-8-5-9(12)2-3-10(8)13/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | YZCNUTKHHUJYAU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|