C12H16Cl3N — CID 79244144
1-chloro-N-[(2,5-dichlorophenyl)methyl]-3-methylbutan-2-amine (PubChem CID 79244144) has the molecular formula C12H16Cl3N and a molecular weight of 280.63 g/mol. Its IUPAC name is 1-chloro-N-[(2,5-dichlorophenyl)methyl]-3-methylbutan-2-amine.
| Compound Name | 1-chloro-N-[(2,5-dichlorophenyl)methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 79244144 |
| Molecular Formula | C12H16Cl3N |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 1-chloro-N-[(2,5-dichlorophenyl)methyl]-3-methylbutan-2-amine |
| SMILES | CC(C)C(CCl)NCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H16Cl3N/c1-8(2)12(6-13)16-7-9-5-10(14)3-4-11(9)15/h3-5,8,12,16H,6-7H2,1-2H3 |
| InChIKey | NUDLVSSQRUIRIJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|