C14H19Cl2NO2 — CID 65315876
methyl 2-[(2,5-dichlorophenyl)methylamino]-4-methylpentanoate (PubChem CID 65315876) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is methyl 2-[(2,5-dichlorophenyl)methylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[(2,5-dichlorophenyl)methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 65315876 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl 2-[(2,5-dichlorophenyl)methylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2/c1-9(2)6-13(14(18)19-3)17-8-10-7-11(15)4-5-12(10)16/h4-5,7,9,13,17H,6,8H2,1-3H3 |
| InChIKey | MROXQOLBZQIWQV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |