C14H20ClFN2O — CID 115762137
2-[(5-chloro-2-fluorophenyl)methylamino]-N,4-dimethylpentanamide (PubChem CID 115762137) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 2-[(5-chloro-2-fluorophenyl)methylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[(5-chloro-2-fluorophenyl)methylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 115762137 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-[(5-chloro-2-fluorophenyl)methylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H20ClFN2O/c1-9(2)6-13(14(19)17-3)18-8-10-7-11(15)4-5-12(10)16/h4-5,7,9,13,18H,6,8H2,1-3H3,(H,17,19) |
| InChIKey | WOCOFSRWGCNAAC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |