C15H23BrN2O2 — CID 103827953
2-[(2-bromo-5-methoxyphenyl)methylamino]-N,4-dimethylpentanamide (PubChem CID 103827953) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 2-[(2-bromo-5-methoxyphenyl)methylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[(2-bromo-5-methoxyphenyl)methylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 103827953 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[(2-bromo-5-methoxyphenyl)methylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NCc1cc(OC)ccc1Br |
| InChI | InChI=1S/C15H23BrN2O2/c1-10(2)7-14(15(19)17-3)18-9-11-8-12(20-4)5-6-13(11)16/h5-6,8,10,14,18H,7,9H2,1-4H3,(H,17,19) |
| InChIKey | XZDVKRYGDJOKLA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |