C14H22N2O3 — CID 43750577
2-[(3,4-dihydroxyphenyl)methylamino]-N,4-dimethylpentanamide (PubChem CID 43750577) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 43750577 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-9(2)6-11(14(19)15-3)16-8-10-4-5-12(17)13(18)7-10/h4-5,7,9,11,16-18H,6,8H2,1-3H3,(H,15,19) |
| InChIKey | QXMLSHOSZPDJOP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|