C18H29NO4 — CID 71919225
tert-butyl (2R)-2-[(3-hydroxy-4-methoxyphenyl)methylamino]-4-methylpentanoate (PubChem CID 71919225) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3-hydroxy-4-methoxyphenyl)methylamino]-4-methylpentanoate.
| Compound Name | tert-butyl (2R)-2-[(3-hydroxy-4-methoxyphenyl)methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 71919225 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl (2R)-2-[(3-hydroxy-4-methoxyphenyl)methylamino]-4-methylpentanoate |
| SMILES | COc1ccc(CN[C@H](CC(C)C)C(=O)OC(C)(C)C)cc1O |
| InChI | InChI=1S/C18H29NO4/c1-12(2)9-14(17(21)23-18(3,4)5)19-11-13-7-8-16(22-6)15(20)10-13/h7-8,10,12,14,19-20H,9,11H2,1-6H3/t14-/m1/s1 |
| InChIKey | OGBVNPOSIRLHTL-CQSZACIVSA-N |
| XLogP | 3.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |