C20H32N2O4 — CID 25059998
tert-butyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate (PubChem CID 25059998) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 25059998 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NCc1ccc(CCC(=O)NO)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O4/c1-14(2)12-17(19(24)26-20(3,4)5)21-13-16-8-6-15(7-9-16)10-11-18(23)22-25/h6-9,14,17,21,25H,10-13H2,1-5H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | URMXPCVXGIBJBY-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|