C20H33N3O4 — CID 87239919
2-(dimethylamino)ethyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate (PubChem CID 87239919) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate.
| Compound Name | 2-(dimethylamino)ethyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 87239919 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-(dimethylamino)ethyl (2S)-2-[[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]methylamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NCc1ccc(CCC(=O)NO)cc1)C(=O)OCCN(C)C |
| InChI | InChI=1S/C20H33N3O4/c1-15(2)13-18(20(25)27-12-11-23(3)4)21-14-17-7-5-16(6-8-17)9-10-19(24)22-26/h5-8,15,18,21,26H,9-14H2,1-4H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | KNLIGIUJIRIYJH-SFHVURJKSA-N |
| XLogP | 1.73 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|