C19H29NO2 — CID 90908653
cyclopentyl 4-methyl-2-[(4-methylphenyl)methylamino]pentanoate (PubChem CID 90908653) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is cyclopentyl 4-methyl-2-[(4-methylphenyl)methylamino]pentanoate.
| Compound Name | cyclopentyl 4-methyl-2-[(4-methylphenyl)methylamino]pentanoate |
|---|---|
| PubChem CID | 90908653 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | cyclopentyl 4-methyl-2-[(4-methylphenyl)methylamino]pentanoate |
| SMILES | Cc1ccc(CNC(CC(C)C)C(=O)OC2CCCC2)cc1 |
| InChI | InChI=1S/C19H29NO2/c1-14(2)12-18(19(21)22-17-6-4-5-7-17)20-13-16-10-8-15(3)9-11-16/h8-11,14,17-18,20H,4-7,12-13H2,1-3H3 |
| InChIKey | DENNOFZAWAHPNT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |