C31H46N2O3 — CID 138642447
cyclopentyl 2-[[3-[[(Z,4E)-4-ethylidene-2,6-dimethyl-7-oxooct-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate (PubChem CID 138642447) has the molecular formula C31H46N2O3 and a molecular weight of 494.72 g/mol. Its IUPAC name is cyclopentyl 2-[[3-[[(Z,4E)-4-ethylidene-2,6-dimethyl-7-oxooct-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate.
| Compound Name | cyclopentyl 2-[[3-[[(Z,4E)-4-ethylidene-2,6-dimethyl-7-oxooct-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 138642447 |
| Molecular Formula | C31H46N2O3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | cyclopentyl 2-[[3-[[(Z,4E)-4-ethylidene-2,6-dimethyl-7-oxooct-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate |
| SMILES | C/C=C(\C=C(\C)C(C)=O)C(=N/c1cc(CNC(CC(C)C)C(=O)OC2CCCC2)ccc1C)/C(C)C |
| InChI | InChI=1S/C31H46N2O3/c1-9-26(17-23(7)24(8)34)30(21(4)5)33-28-18-25(15-14-22(28)6)19-32-29(16-20(2)3)31(35)36-27-12-10-11-13-27/h9,14-15,17-18,20-21,27,29,32H,10-13,16,19H2,1-8H3/b23-17-,26-9+,33-30+ |
| InChIKey | JCMUJEAWESPNND-XCMZFVHUSA-N |
| XLogP | 7.20 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|