C30H46N2O3 — CID 138642455
tert-butyl 2-[[3-[[(Z,5E)-5-ethylidene-3,7-dimethyl-8-oxooct-6-en-4-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate (PubChem CID 138642455) has the molecular formula C30H46N2O3 and a molecular weight of 482.71 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[(Z,5E)-5-ethylidene-3,7-dimethyl-8-oxooct-6-en-4-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[3-[[(Z,5E)-5-ethylidene-3,7-dimethyl-8-oxooct-6-en-4-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 138642455 |
| Molecular Formula | C30H46N2O3 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | tert-butyl 2-[[3-[[(Z,5E)-5-ethylidene-3,7-dimethyl-8-oxooct-6-en-4-ylidene]amino]-4-methylphenyl]methylamino]-4-methylpentanoate |
| SMILES | C/C=C(\C=C(\C)C=O)C(=N/c1cc(CNC(CC(C)C)C(=O)OC(C)(C)C)ccc1C)/C(C)CC |
| InChI | InChI=1S/C30H46N2O3/c1-11-22(6)28(25(12-2)16-21(5)19-33)32-26-17-24(14-13-23(26)7)18-31-27(15-20(3)4)29(34)35-30(8,9)10/h12-14,16-17,19-20,22,27,31H,11,15,18H2,1-10H3/b21-16-,25-12+,32-28+ |
| InChIKey | BFYCYNOAWNBPCG-ZLRUGWOISA-N |
| XLogP | 7.05 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|