C25H39NO5 — CID 13178370
tert-butyl 2-[[3-ethoxy-3-oxo-2-[(4-propan-2-ylphenyl)methyl]propanoyl]amino]-4-methylpentanoate (PubChem CID 13178370) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is tert-butyl 2-[[3-ethoxy-3-oxo-2-[(4-propan-2-ylphenyl)methyl]propanoyl]amino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[3-ethoxy-3-oxo-2-[(4-propan-2-ylphenyl)methyl]propanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 13178370 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | tert-butyl 2-[[3-ethoxy-3-oxo-2-[(4-propan-2-ylphenyl)methyl]propanoyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C(C)C)cc1)C(=O)NC(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H39NO5/c1-9-30-23(28)20(15-18-10-12-19(13-11-18)17(4)5)22(27)26-21(14-16(2)3)24(29)31-25(6,7)8/h10-13,16-17,20-21H,9,14-15H2,1-8H3,(H,26,27) |
| InChIKey | WEPWCDVCKIEKLP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|