C22H34N2O4 — CID 158441140
tert-butyl (2S)-4-methyl-2-[[(3S)-3-methyl-2-oxo-4-phenylbutyl]carbamoylamino]pentanoate (PubChem CID 158441140) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl (2S)-4-methyl-2-[[(3S)-3-methyl-2-oxo-4-phenylbutyl]carbamoylamino]pentanoate.
| Compound Name | tert-butyl (2S)-4-methyl-2-[[(3S)-3-methyl-2-oxo-4-phenylbutyl]carbamoylamino]pentanoate |
|---|---|
| PubChem CID | 158441140 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | tert-butyl (2S)-4-methyl-2-[[(3S)-3-methyl-2-oxo-4-phenylbutyl]carbamoylamino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)NCC(=O)[C@@H](C)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34N2O4/c1-15(2)12-18(20(26)28-22(4,5)6)24-21(27)23-14-19(25)16(3)13-17-10-8-7-9-11-17/h7-11,15-16,18H,12-14H2,1-6H3,(H2,23,24,27)/t16-,18-/m0/s1 |
| InChIKey | HCVCPWFELAKQOS-WMZOPIPTSA-N |
| XLogP | 3.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |