C30H41N3O6 — CID 10578350
ethyl 2-benzyl-3-[[(1S)-2-methyl-1-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propyl]amino]-3-oxopropanoate (PubChem CID 10578350) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is ethyl 2-benzyl-3-[[(1S)-2-methyl-1-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propyl]amino]-3-oxopropanoate.
| Compound Name | ethyl 2-benzyl-3-[[(1S)-2-methyl-1-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10578350 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | ethyl 2-benzyl-3-[[(1S)-2-methyl-1-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propyl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)N[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C30H41N3O6/c1-7-38-28(36)23(18-21-14-10-8-11-15-21)26(34)32-25(20(2)3)33-27(35)24(19-22-16-12-9-13-17-22)31-29(37)39-30(4,5)6/h8-17,20,23-25H,7,18-19H2,1-6H3,(H,31,37)(H,32,34)(H,33,35)/t23?,24-,25-/m0/s1 |
| InChIKey | UWSSXOPBCZEAGN-DJHGOXGWSA-N |
| XLogP | 3.76 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|