C20H28N2O2 — CID 75380269
tert-butyl (2R)-4-methyl-2-(quinolin-8-ylmethylamino)pentanoate (PubChem CID 75380269) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is tert-butyl (2R)-4-methyl-2-(quinolin-8-ylmethylamino)pentanoate.
| Compound Name | tert-butyl (2R)-4-methyl-2-(quinolin-8-ylmethylamino)pentanoate |
|---|---|
| PubChem CID | 75380269 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl (2R)-4-methyl-2-(quinolin-8-ylmethylamino)pentanoate |
| SMILES | CC(C)C[C@@H](NCc1cccc2cccnc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28N2O2/c1-14(2)12-17(19(23)24-20(3,4)5)22-13-16-9-6-8-15-10-7-11-21-18(15)16/h6-11,14,17,22H,12-13H2,1-5H3/t17-/m1/s1 |
| InChIKey | HMHNQTKAHDLMEP-QGZVFWFLSA-N |
| XLogP | 4.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |