C19H24N2O3 — CID 95981734
methyl (2S)-4-methyl-2-[[(2-quinolin-8-ylacetyl)amino]methyl]pentanoate (PubChem CID 95981734) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[(2-quinolin-8-ylacetyl)amino]methyl]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[(2-quinolin-8-ylacetyl)amino]methyl]pentanoate |
|---|---|
| PubChem CID | 95981734 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[(2-quinolin-8-ylacetyl)amino]methyl]pentanoate |
| SMILES | COC(=O)C(CNC(=O)Cc1cccc2cccnc12)CC(C)C |
| InChI | InChI=1S/C19H24N2O3/c1-13(2)10-16(19(23)24-3)12-21-17(22)11-15-7-4-6-14-8-5-9-20-18(14)15/h4-9,13,16H,10-12H2,1-3H3,(H,21,22) |
| InChIKey | WFSMGFMGMLNVPH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |