C20H26ClN3O3 — CID 15982710
2-amino-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-N,N-dimethylpropanamide;hydrochloride (PubChem CID 15982710) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-N,N-dimethylpropanamide;hydrochloride.
| Compound Name | 2-amino-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-N,N-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 15982710 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-amino-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-N,N-dimethylpropanamide;hydrochloride |
| SMILES | CN(C)C(=O)C(N)Cc1ccc(-c2ccc(CCC(=O)NO)cc2)cc1.Cl |
| InChI | InChI=1S/C20H25N3O3.ClH/c1-23(2)20(25)18(21)13-15-5-10-17(11-6-15)16-8-3-14(4-9-16)7-12-19(24)22-26;/h3-6,8-11,18,26H,7,12-13,21H2,1-2H3,(H,22,24);1H |
| InChIKey | DJXQPNYZARJZFS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|