C31H37N3O5 — CID 72551666
tert-butyl N-[1-(dimethylamino)-1-oxo-3-[4-[4-[3-oxo-3-(phenoxyamino)propyl]phenyl]phenyl]propan-2-yl]carbamate (PubChem CID 72551666) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is tert-butyl N-[1-(dimethylamino)-1-oxo-3-[4-[4-[3-oxo-3-(phenoxyamino)propyl]phenyl]phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(dimethylamino)-1-oxo-3-[4-[4-[3-oxo-3-(phenoxyamino)propyl]phenyl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 72551666 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | tert-butyl N-[1-(dimethylamino)-1-oxo-3-[4-[4-[3-oxo-3-(phenoxyamino)propyl]phenyl]phenyl]propan-2-yl]carbamate |
| SMILES | CN(C)C(=O)C(Cc1ccc(-c2ccc(CCC(=O)NOc3ccccc3)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H37N3O5/c1-31(2,3)38-30(37)32-27(29(36)34(4)5)21-23-13-18-25(19-14-23)24-16-11-22(12-17-24)15-20-28(35)33-39-26-9-7-6-8-10-26/h6-14,16-19,27H,15,20-21H2,1-5H3,(H,32,37)(H,33,35) |
| InChIKey | DEKVYDZUNHMULW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|