C25H33N3O5 — CID 72551664
tert-butyl N-[1-(dimethylamino)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 72551664) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl N-[1-(dimethylamino)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(dimethylamino)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 72551664 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl N-[1-(dimethylamino)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenyl]phenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CN(C)C(=O)C(Cc1ccc(-c2ccc(CCC(=O)NO)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33N3O5/c1-25(2,3)33-24(31)26-21(23(30)28(4)5)16-18-8-13-20(14-9-18)19-11-6-17(7-12-19)10-15-22(29)27-32/h6-9,11-14,21,32H,10,15-16H2,1-5H3,(H,26,31)(H,27,29) |
| InChIKey | CKOKWYWBWSPAGC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|