C27H32N3O5PS — CID 89371068
(2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phosphanyloxyamino)propyl]phenyl]phenyl]propanamide (PubChem CID 89371068) has the molecular formula C27H32N3O5PS and a molecular weight of 541.61 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phosphanyloxyamino)propyl]phenyl]phenyl]propanamide.
| Compound Name | (2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phosphanyloxyamino)propyl]phenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 89371068 |
| Molecular Formula | C27H32N3O5PS |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phosphanyloxyamino)propyl]phenyl]phenyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(-c3ccc(CCC(=O)NOP)cc3)cc2)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C27H32N3O5PS/c1-19-4-15-24(16-5-19)37(33,34)29-25(27(32)30(2)3)18-21-8-13-23(14-9-21)22-11-6-20(7-12-22)10-17-26(31)28-35-36/h4-9,11-16,25,29H,10,17-18,36H2,1-3H3,(H,28,31)/t25-/m0/s1 |
| InChIKey | KHEUWGUQAJWFAM-VWLOTQADSA-N |
| XLogP | 3.41 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|