C34H37N3O6S — CID 58792136
(2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phenylmethoxyamino)propyl]phenoxy]phenyl]propanamide (PubChem CID 58792136) has the molecular formula C34H37N3O6S and a molecular weight of 615.75 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phenylmethoxyamino)propyl]phenoxy]phenyl]propanamide.
| Compound Name | (2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phenylmethoxyamino)propyl]phenoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 58792136 |
| Molecular Formula | C34H37N3O6S |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | (2S)-N,N-dimethyl-2-[(4-methylphenyl)sulfonylamino]-3-[4-[4-[3-oxo-3-(phenylmethoxyamino)propyl]phenoxy]phenyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(Oc3ccc(CCC(=O)NOCc4ccccc4)cc3)cc2)C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C34H37N3O6S/c1-25-9-20-31(21-10-25)44(40,41)36-32(34(39)37(2)3)23-27-13-18-30(19-14-27)43-29-16-11-26(12-17-29)15-22-33(38)35-42-24-28-7-5-4-6-8-28/h4-14,16-21,32,36H,15,22-24H2,1-3H3,(H,35,38)/t32-/m0/s1 |
| InChIKey | ICYLFWWEUOKNKO-YTTGMZPUSA-N |
| XLogP | 4.95 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|