C20H26ClN3O4 — CID 15982716
2-amino-3-[4-[2-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-N,N-dimethylpropanamide;hydrochloride (PubChem CID 15982716) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is 2-amino-3-[4-[2-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-N,N-dimethylpropanamide;hydrochloride.
| Compound Name | 2-amino-3-[4-[2-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-N,N-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 15982716 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-amino-3-[4-[2-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-N,N-dimethylpropanamide;hydrochloride |
| SMILES | CN(C)C(=O)C(N)Cc1ccc(Oc2ccccc2CCC(=O)NO)cc1.Cl |
| InChI | InChI=1S/C20H25N3O4.ClH/c1-23(2)20(25)17(21)13-14-7-10-16(11-8-14)27-18-6-4-3-5-15(18)9-12-19(24)22-26;/h3-8,10-11,17,26H,9,12-13,21H2,1-2H3,(H,22,24);1H |
| InChIKey | PGCYLJKIEPUUEH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|