C22H25Cl2N5O4 — CID 25142890
(2R)-2-amino-N,N-dimethyl-3-[4-[4-[(3-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanamide;dihydrochloride (PubChem CID 25142890) has the molecular formula C22H25Cl2N5O4 and a molecular weight of 494.38 g/mol. Its IUPAC name is (2R)-2-amino-N,N-dimethyl-3-[4-[4-[(3-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanamide;dihydrochloride.
| Compound Name | (2R)-2-amino-N,N-dimethyl-3-[4-[4-[(3-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 25142890 |
| Molecular Formula | C22H25Cl2N5O4 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (2R)-2-amino-N,N-dimethyl-3-[4-[4-[(3-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanamide;dihydrochloride |
| SMILES | CN(C)C(=O)[C@H](N)Cc1ccc(Oc2ccc(Nc3ncccc3[N+](=O)[O-])cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H23N5O4.2ClH/c1-26(2)22(28)19(23)14-15-5-9-17(10-6-15)31-18-11-7-16(8-12-18)25-21-20(27(29)30)4-3-13-24-21;;/h3-13,19H,14,23H2,1-2H3,(H,24,25);2*1H/t19-;;/m1../s1 |
| InChIKey | PYYKOWQQGDSOID-JQDLGSOUSA-N |
| XLogP | 4.33 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|