C20H20Cl2N4O5 — CID 68906740
(2S)-2-amino-3-[4-[4-[(5-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanoic acid;dihydrochloride (PubChem CID 68906740) has the molecular formula C20H20Cl2N4O5 and a molecular weight of 467.31 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[4-[(5-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanoic acid;dihydrochloride.
| Compound Name | (2S)-2-amino-3-[4-[4-[(5-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 68906740 |
| Molecular Formula | C20H20Cl2N4O5 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (2S)-2-amino-3-[4-[4-[(5-nitro-2-pyridinyl)amino]phenoxy]phenyl]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](Cc1ccc(Oc2ccc(Nc3ccc([N+](=O)[O-])cn3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H18N4O5.2ClH/c21-18(20(25)26)11-13-1-6-16(7-2-13)29-17-8-3-14(4-9-17)23-19-10-5-15(12-22-19)24(27)28;;/h1-10,12,18H,11,21H2,(H,22,23)(H,25,26);2*1H/t18-;;/m0../s1 |
| InChIKey | YALLKGYAEZBFDH-NTEVMMBTSA-N |
| XLogP | 4.32 |
| TPSA | 140.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|