C10H12N6O4 — CID 67515651
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid;2H-tetrazole (PubChem CID 67515651) has the molecular formula C10H12N6O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-nitrophenyl)propanoic acid;2H-tetrazole.
| Compound Name | (2S)-2-amino-3-(4-nitrophenyl)propanoic acid;2H-tetrazole |
|---|---|
| PubChem CID | 67515651 |
| Molecular Formula | C10H12N6O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (2S)-2-amino-3-(4-nitrophenyl)propanoic acid;2H-tetrazole |
| SMILES | N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)O.c1nn[nH]n1 |
| InChI | InChI=1S/C9H10N2O4.CH2N4/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15;1-2-4-5-3-1/h1-4,8H,5,10H2,(H,12,13);1H,(H,2,3,4,5)/t8-;/m0./s1 |
| InChIKey | CRFGQSAUTSYACS-QRPNPIFTSA-N |
| XLogP | -0.25 |
| TPSA | 160.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|