C10H12N2O5 — CID 45157639
(2S,3R)-3-amino-2-hydroxy-4-(4-nitrophenyl)butanoic acid (PubChem CID 45157639) has the molecular formula C10H12N2O5 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-hydroxy-4-(4-nitrophenyl)butanoic acid.
| Compound Name | (2S,3R)-3-amino-2-hydroxy-4-(4-nitrophenyl)butanoic acid |
|---|---|
| PubChem CID | 45157639 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2S,3R)-3-amino-2-hydroxy-4-(4-nitrophenyl)butanoic acid |
| SMILES | N[C@H](Cc1ccc([N+](=O)[O-])cc1)[C@H](O)C(=O)O |
| InChI | InChI=1S/C10H12N2O5/c11-8(9(13)10(14)15)5-6-1-3-7(4-2-6)12(16)17/h1-4,8-9,13H,5,11H2,(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | CSDZRIXBILAEBT-BDAKNGLRSA-N |
| XLogP | -0.09 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|