About magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate
magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate (PubChem CID 139719111) has the molecular formula C10H11MgNO8
and a molecular weight of 297.50 g/mol. Its IUPAC name is magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate.
Molecular Properties
| Compound Name | magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate |
| PubChem CID | 139719111 |
| Molecular Formula | C10H11MgNO8 |
| Molecular Weight | 297.50 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate |
| SMILES | O.O.O=C([O-])C(Cc1ccc([N+](=O)[O-])cc1)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C10H9NO6.Mg.2H2O/c12-9(13)8(10(14)15)5-6-1-3-7(4-2-6)11(16)17;;;/h1-4,8H,5H2,(H,12,13)(H,14,15);;2*1H2/q;+2;;/p-2 |
| InChIKey | MXTHHUUBLZGALB-UHFFFAOYSA-L |
| XLogP | -3.78 |
| TPSA | 186.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.50 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate?
The IUPAC name of magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate (CID 139719111) is magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate.
What is the SMILES notation for magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate?
The canonical SMILES for magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate is O.O.O=C([O-])C(Cc1ccc([N+](=O)[O-])cc1)C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate?
The InChIKey is MXTHHUUBLZGALB-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9NO6.Mg.2H2O/c12-9(13)8(10(14)15)5-6-1-3-7(4-2-6)11(16)17;;;/h1-4,8H,5H2,(H,12,13)(H,14,15);;2*1H2/q;+2;;/p-2.
What are the key properties of magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate?
magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate has a molecular weight of 297.50 g/mol, XLogP of -3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-[(4-nitrophenyl)methyl]propanedioate;dihydrate is sourced from PubChem (CID 139719111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).