C10H12ClN3O4 — CID 153324526
3-amino-N-chloro-2-hydroxy-4-(4-nitrophenyl)butanamide (PubChem CID 153324526) has the molecular formula C10H12ClN3O4 and a molecular weight of 273.68 g/mol. Its IUPAC name is 3-amino-N-chloro-2-hydroxy-4-(4-nitrophenyl)butanamide.
| Compound Name | 3-amino-N-chloro-2-hydroxy-4-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 153324526 |
| Molecular Formula | C10H12ClN3O4 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3-amino-N-chloro-2-hydroxy-4-(4-nitrophenyl)butanamide |
| SMILES | NC(Cc1ccc([N+](=O)[O-])cc1)C(O)C(=O)NCl |
| InChI | InChI=1S/C10H12ClN3O4/c11-13-10(16)9(15)8(12)5-6-1-3-7(4-2-6)14(17)18/h1-4,8-9,15H,5,12H2,(H,13,16) |
| InChIKey | LYUGGIJQBGXEPB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|