C9H10AgN2O5 — CID 174523785
(2S)-2-amino-3-(4-nitrooxyphenyl)propanoic acid;silver (PubChem CID 174523785) has the molecular formula C9H10AgN2O5 and a molecular weight of 334.06 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-nitrooxyphenyl)propanoic acid;silver.
| Compound Name | (2S)-2-amino-3-(4-nitrooxyphenyl)propanoic acid;silver |
|---|---|
| PubChem CID | 174523785 |
| Molecular Formula | C9H10AgN2O5 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | (2S)-2-amino-3-(4-nitrooxyphenyl)propanoic acid;silver |
| SMILES | N[C@@H](Cc1ccc(O[N+](=O)[O-])cc1)C(=O)O.[Ag] |
| InChI | InChI=1S/C9H10N2O5.Ag/c10-8(9(12)13)5-6-1-3-7(4-2-6)16-11(14)15;/h1-4,8H,5,10H2,(H,12,13);/t8-;/m0./s1 |
| InChIKey | VDTONYCSOHCCJH-QRPNPIFTSA-N |
| XLogP | 0.21 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|