C17H15ClN4O5 — CID 164571343
(2S)-2-amino-3-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoic acid;hydrochloride (PubChem CID 164571343) has the molecular formula C17H15ClN4O5 and a molecular weight of 390.78 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 164571343 |
| Molecular Formula | C17H15ClN4O5 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (2S)-2-amino-3-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccc(-c2noc(-c3ccc([N+](=O)[O-])cc3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C17H14N4O5.ClH/c18-14(17(22)23)9-10-1-3-11(4-2-10)15-19-16(26-20-15)12-5-7-13(8-6-12)21(24)25;/h1-8,14H,9,18H2,(H,22,23);1H/t14-;/m0./s1 |
| InChIKey | PCAIJFRXNIUYHR-UQKRIMTDSA-N |
| XLogP | 2.69 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|