C12H11N3O4 — CID 63344494
3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 63344494) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 63344494 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CC(=O)C(C)c1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C12H11N3O4/c1-7(8(2)16)12-13-11(14-19-12)9-3-5-10(6-4-9)15(17)18/h3-7H,1-2H3 |
| InChIKey | FHNQKKIKMIPOQH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|