C18H15FN4O4 — CID 49179718
N-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(4-nitrophenyl)acetamide (PubChem CID 49179718) has the molecular formula C18H15FN4O4 and a molecular weight of 370.34 g/mol. Its IUPAC name is N-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 49179718 |
| Molecular Formula | C18H15FN4O4 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(4-nitrophenyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccc([N+](=O)[O-])cc1)c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C18H15FN4O4/c1-11(18-21-17(22-27-18)13-4-6-14(19)7-5-13)20-16(24)10-12-2-8-15(9-3-12)23(25)26/h2-9,11H,10H2,1H3,(H,20,24) |
| InChIKey | KPONTYCQTRLHSG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|