C21H21FN4O4 — CID 91634962
2-(4-fluorophenyl)-N-[2-methyl-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide (PubChem CID 91634962) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-methyl-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-methyl-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide |
|---|---|
| PubChem CID | 91634962 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-methyl-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butyl]acetamide |
| SMILES | CCC(C)C(NC(=O)Cc1ccc(F)cc1)c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C21H21FN4O4/c1-3-13(2)19(23-18(27)11-14-7-9-16(22)10-8-14)21-24-20(25-30-21)15-5-4-6-17(12-15)26(28)29/h4-10,12-13,19H,3,11H2,1-2H3,(H,23,27) |
| InChIKey | VNIFIIVRPUFESN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|