C24H19FN4O4 — CID 97038139
2-(4-fluorophenyl)-N-[(1S)-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]acetamide (PubChem CID 97038139) has the molecular formula C24H19FN4O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(1S)-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(1S)-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]acetamide |
|---|---|
| PubChem CID | 97038139 |
| Molecular Formula | C24H19FN4O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(1S)-1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)N[C@@H](Cc1ccccc1)c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C24H19FN4O4/c25-19-11-9-17(10-12-19)14-22(30)26-21(13-16-5-2-1-3-6-16)24-27-23(28-33-24)18-7-4-8-20(15-18)29(31)32/h1-12,15,21H,13-14H2,(H,26,30)/t21-/m0/s1 |
| InChIKey | AUFNSEPAASLPHV-NRFANRHFSA-N |
| XLogP | 4.43 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|