C22H25N5O4 — CID 42792330
6-amino-N-[1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]hexanamide (PubChem CID 42792330) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 6-amino-N-[1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]hexanamide.
| Compound Name | 6-amino-N-[1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]hexanamide |
|---|---|
| PubChem CID | 42792330 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 6-amino-N-[1-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]hexanamide |
| SMILES | NCCCCCC(=O)NC(Cc1ccccc1)c1nc(-c2cccc([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C22H25N5O4/c23-13-6-2-5-12-20(28)24-19(14-16-8-3-1-4-9-16)22-25-21(26-31-22)17-10-7-11-18(15-17)27(29)30/h1,3-4,7-11,15,19H,2,5-6,12-14,23H2,(H,24,28) |
| InChIKey | DIXZUBLDSWTUJQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|