C20H26N2O — CID 42792343
6-amino-N-(1,2-diphenylethyl)hexanamide (PubChem CID 42792343) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 6-amino-N-(1,2-diphenylethyl)hexanamide.
| Compound Name | 6-amino-N-(1,2-diphenylethyl)hexanamide |
|---|---|
| PubChem CID | 42792343 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 6-amino-N-(1,2-diphenylethyl)hexanamide |
| SMILES | NCCCCCC(=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c21-15-9-3-8-14-20(23)22-19(18-12-6-2-7-13-18)16-17-10-4-1-5-11-17/h1-2,4-7,10-13,19H,3,8-9,14-16,21H2,(H,22,23) |
| InChIKey | ADPBIRDCCWGIGG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|