C20H34N2O4 — CID 160625754
3-(9-aminononanoylamino)-3-phenylpropanoic acid;methoxymethane (PubChem CID 160625754) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 3-(9-aminononanoylamino)-3-phenylpropanoic acid;methoxymethane.
| Compound Name | 3-(9-aminononanoylamino)-3-phenylpropanoic acid;methoxymethane |
|---|---|
| PubChem CID | 160625754 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 3-(9-aminononanoylamino)-3-phenylpropanoic acid;methoxymethane |
| SMILES | COC.NCCCCCCCCC(=O)NC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H28N2O3.C2H6O/c19-13-9-4-2-1-3-8-12-17(21)20-16(14-18(22)23)15-10-6-5-7-11-15;1-3-2/h5-7,10-11,16H,1-4,8-9,12-14,19H2,(H,20,21)(H,22,23);1-2H3 |
| InChIKey | RHGUNCIBKLVXFP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|