C20H26N2O3 — CID 119312826
4-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]butanamide (PubChem CID 119312826) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]butanamide.
| Compound Name | 4-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 119312826 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]butanamide |
| SMILES | COc1ccc(CC(NC(=O)CCCN)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H26N2O3/c1-24-18-11-10-15(14-19(18)25-2)13-17(16-7-4-3-5-8-16)22-20(23)9-6-12-21/h3-5,7-8,10-11,14,17H,6,9,12-13,21H2,1-2H3,(H,22,23) |
| InChIKey | CNTFJZLTSPFRRV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |