C19H22N2O4 — CID 51492377
N-[(1R)-2-amino-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 51492377) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[(1R)-2-amino-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | N-[(1R)-2-amino-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 51492377 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(1R)-2-amino-2-oxo-1-phenylethyl]-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)N[C@@H](C(N)=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22N2O4/c1-24-15-10-8-13(12-16(15)25-2)9-11-17(22)21-18(19(20)23)14-6-4-3-5-7-14/h3-8,10,12,18H,9,11H2,1-2H3,(H2,20,23)(H,21,22)/t18-/m1/s1 |
| InChIKey | CLJHTUGXONBTTL-GOSISDBHSA-N |
| XLogP | 1.98 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |