C20H23NO6 — CID 119367644
(2R)-2-phenyl-2-[3-(3,4,5-trimethoxyphenyl)propanoylamino]acetic acid (PubChem CID 119367644) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[3-(3,4,5-trimethoxyphenyl)propanoylamino]acetic acid.
| Compound Name | (2R)-2-phenyl-2-[3-(3,4,5-trimethoxyphenyl)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 119367644 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (2R)-2-phenyl-2-[3-(3,4,5-trimethoxyphenyl)propanoylamino]acetic acid |
| SMILES | COc1cc(CCC(=O)N[C@@H](C(=O)O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23NO6/c1-25-15-11-13(12-16(26-2)19(15)27-3)9-10-17(22)21-18(20(23)24)14-7-5-4-6-8-14/h4-8,11-12,18H,9-10H2,1-3H3,(H,21,22)(H,23,24)/t18-/m1/s1 |
| InChIKey | LBRJEWXCYCDZGP-GOSISDBHSA-N |
| XLogP | 2.59 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |