C27H31NO4 — CID 55588897
N-(1,1-diphenylpropan-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 55588897) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-(1,1-diphenylpropan-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-(1,1-diphenylpropan-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55588897 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-(1,1-diphenylpropan-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)NC(C)C(c2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H31NO4/c1-19(26(21-11-7-5-8-12-21)22-13-9-6-10-14-22)28-25(29)16-15-20-17-23(30-2)27(32-4)24(18-20)31-3/h5-14,17-19,26H,15-16H2,1-4H3,(H,28,29) |
| InChIKey | OQVFQWLVFDUFJK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |